C24H17Cl4N3O2S — CID 3574868
2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-N-(3,5-dichlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3574868) has the molecular formula C24H17Cl4N3O2S and a molecular weight of 553.30 g/mol. Its IUPAC name is 2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-N-(3,5-dichlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-N-(3,5-dichlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3574868 |
| Molecular Formula | C24H17Cl4N3O2S |
| Molecular Weight | 553.30 g/mol |
| Exact Mass | 550.98 |
| IUPAC Name | 2-(4-chlorophenyl)imino-3-[(4-chlorophenyl)methyl]-N-(3,5-dichlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C1CC(=O)N(Cc2ccc(Cl)cc2)/C(=N/c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C24H17Cl4N3O2S/c25-15-3-1-14(2-4-15)13-31-22(32)12-21(23(33)29-20-10-17(27)9-18(28)11-20)34-24(31)30-19-7-5-16(26)6-8-19/h1-11,21H,12-13H2,(H,29,33)/b30-24- |
| InChIKey | BCVUMSCRUWJDPS-KRUMMXJUSA-N |
| XLogP | 7.46 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.30 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|