C25H20ClN3O4S — CID 92847614
4-[[(6S)-3-[(4-chlorophenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 92847614) has the molecular formula C25H20ClN3O4S and a molecular weight of 493.97 g/mol. Its IUPAC name is 4-[[(6S)-3-[(4-chlorophenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6S)-3-[(4-chlorophenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 92847614 |
| Molecular Formula | C25H20ClN3O4S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-[[(6S)-3-[(4-chlorophenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@@H]2CC(=O)N(Cc3ccc(Cl)cc3)/C(=N/c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C25H20ClN3O4S/c26-18-10-6-16(7-11-18)15-29-22(30)14-21(34-25(29)28-19-4-2-1-3-5-19)23(31)27-20-12-8-17(9-13-20)24(32)33/h1-13,21H,14-15H2,(H,27,31)(H,32,33)/b28-25-/t21-/m0/s1 |
| InChIKey | MMSMPVFAPIUWBX-UBUZMBAGSA-N |
| XLogP | 5.20 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|