C26H23ClIN3O4S — CID 4111241
2-(4-chlorophenyl)imino-3-[(3,4-dimethoxyphenyl)methyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4111241) has the molecular formula C26H23ClIN3O4S and a molecular weight of 635.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)imino-3-[(3,4-dimethoxyphenyl)methyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(4-chlorophenyl)imino-3-[(3,4-dimethoxyphenyl)methyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4111241 |
| Molecular Formula | C26H23ClIN3O4S |
| Molecular Weight | 635.91 g/mol |
| Exact Mass | 635.01 |
| IUPAC Name | 2-(4-chlorophenyl)imino-3-[(3,4-dimethoxyphenyl)methyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CN2C(=O)CC(C(=O)Nc3ccc(I)cc3)S/C2=N\c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C26H23ClIN3O4S/c1-34-21-12-3-16(13-22(21)35-2)15-31-24(32)14-23(25(33)29-19-10-6-18(28)7-11-19)36-26(31)30-20-8-4-17(27)5-9-20/h3-13,23H,14-15H2,1-2H3,(H,29,33)/b30-26- |
| InChIKey | WDTSWLDRYPOHTJ-BXVZCJGGSA-N |
| XLogP | 6.12 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.91 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|