C26H24FN3O4S — CID 4228254
3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide (PubChem CID 4228254) has the molecular formula C26H24FN3O4S and a molecular weight of 493.56 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4228254 |
| Molecular Formula | C26H24FN3O4S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-N-phenyl-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CN2C(=O)CC(C(=O)Nc3ccccc3)S/C2=N\c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C26H24FN3O4S/c1-33-21-13-8-17(14-22(21)34-2)16-30-24(31)15-23(25(32)28-19-6-4-3-5-7-19)35-26(30)29-20-11-9-18(27)10-12-20/h3-14,23H,15-16H2,1-2H3,(H,28,32)/b29-26- |
| InChIKey | LCFOZROHEFLDTD-WCTVFOPTSA-N |
| XLogP | 5.00 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|