C26H23BrFN3O4S — CID 4112543
N-(3-bromophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4112543) has the molecular formula C26H23BrFN3O4S and a molecular weight of 572.46 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(3-bromophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4112543 |
| Molecular Formula | C26H23BrFN3O4S |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 571.06 |
| IUPAC Name | N-(3-bromophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CN2C(=O)CC(C(=O)Nc3cccc(Br)c3)S/C2=N\c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C26H23BrFN3O4S/c1-34-21-11-6-16(12-22(21)35-2)15-31-24(32)14-23(25(33)29-20-5-3-4-17(27)13-20)36-26(31)30-19-9-7-18(28)8-10-19/h3-13,23H,14-15H2,1-2H3,(H,29,33)/b30-26- |
| InChIKey | GILKMBRAIVELSD-BXVZCJGGSA-N |
| XLogP | 5.77 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|