C28H26ClN3O6S — CID 98094425
4-[[(6S)-2-(4-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 98094425) has the molecular formula C28H26ClN3O6S and a molecular weight of 568.05 g/mol. Its IUPAC name is 4-[[(6S)-2-(4-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6S)-2-(4-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 98094425 |
| Molecular Formula | C28H26ClN3O6S |
| Molecular Weight | 568.05 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 4-[[(6S)-2-(4-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | COc1ccc(CCN2C(=O)C[C@@H](C(=O)Nc3ccc(C(=O)O)cc3)S/C2=N\c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C28H26ClN3O6S/c1-37-22-12-3-17(15-23(22)38-2)13-14-32-25(33)16-24(39-28(32)31-21-10-6-19(29)7-11-21)26(34)30-20-8-4-18(5-9-20)27(35)36/h3-12,15,24H,13-14,16H2,1-2H3,(H,30,34)(H,35,36)/b31-28-/t24-/m0/s1 |
| InChIKey | MCXVRROGDUZYPQ-UCSRTCPSSA-N |
| XLogP | 5.26 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.05 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|