C27H25ClIN3O4S — CID 4046883
2-(3-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4046883) has the molecular formula C27H25ClIN3O4S and a molecular weight of 649.94 g/mol. Its IUPAC name is 2-(3-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4046883 |
| Molecular Formula | C27H25ClIN3O4S |
| Molecular Weight | 649.94 g/mol |
| Exact Mass | 649.03 |
| IUPAC Name | 2-(3-chlorophenyl)imino-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(4-iodophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CCN2C(=O)CC(C(=O)Nc3ccc(I)cc3)S/C2=N\c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C27H25ClIN3O4S/c1-35-22-11-6-17(14-23(22)36-2)12-13-32-25(33)16-24(26(34)30-20-9-7-19(29)8-10-20)37-27(32)31-21-5-3-4-18(28)15-21/h3-11,14-15,24H,12-13,16H2,1-2H3,(H,30,34)/b31-27- |
| InChIKey | AUMMZSWHMOBTPW-QVTSOHHYSA-N |
| XLogP | 6.16 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.94 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|