C29H31N3O5S — CID 6550170
(6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide (PubChem CID 6550170) has the molecular formula C29H31N3O5S and a molecular weight of 533.65 g/mol. Its IUPAC name is (6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 6550170 |
| Molecular Formula | C29H31N3O5S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1cccc(NC(=O)[C@@H]2CC(=O)N(CCc3ccc(OC)c(OC)c3)/C(=N/c3ccccc3)S2)c1 |
| InChI | InChI=1S/C29H31N3O5S/c1-4-37-23-12-8-11-22(18-23)30-28(34)26-19-27(33)32(29(38-26)31-21-9-6-5-7-10-21)16-15-20-13-14-24(35-2)25(17-20)36-3/h5-14,17-18,26H,4,15-16,19H2,1-3H3,(H,30,34)/b31-29-/t26-/m0/s1 |
| InChIKey | NHXOFBMRYZZUBL-NFMXCSJRSA-N |
| XLogP | 5.31 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|