C28H28FN3O3S — CID 4604016
N-(3-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide (PubChem CID 4604016) has the molecular formula C28H28FN3O3S and a molecular weight of 505.62 g/mol. Its IUPAC name is N-(3-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(3-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4604016 |
| Molecular Formula | C28H28FN3O3S |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N-(3-ethoxyphenyl)-2-(4-fluorophenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1cccc(NC(=O)C2CC(=O)N(CCCc3ccccc3)/C(=N/c3ccc(F)cc3)S2)c1 |
| InChI | InChI=1S/C28H28FN3O3S/c1-2-35-24-12-6-11-23(18-24)30-27(34)25-19-26(33)32(17-7-10-20-8-4-3-5-9-20)28(36-25)31-22-15-13-21(29)14-16-22/h3-6,8-9,11-16,18,25H,2,7,10,17,19H2,1H3,(H,30,34)/b31-28- |
| InChIKey | ZAMFGVNHPXDQEQ-PNOGMODKSA-N |
| XLogP | 5.82 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|