C30H33N3O6S — CID 98084422
(6R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 98084422) has the molecular formula C30H33N3O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is (6R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 98084422 |
| Molecular Formula | C30H33N3O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (6R)-3-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-ethoxyphenyl)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1cccc(NC(=O)[C@H]2CC(=O)N(CCc3ccc(OC)c(OC)c3)/C(=N/c3ccc(OC)cc3)S2)c1 |
| InChI | InChI=1S/C30H33N3O6S/c1-5-39-24-8-6-7-22(18-24)31-29(35)27-19-28(34)33(16-15-20-9-14-25(37-3)26(17-20)38-4)30(40-27)32-21-10-12-23(36-2)13-11-21/h6-14,17-18,27H,5,15-16,19H2,1-4H3,(H,31,35)/b32-30-/t27-/m1/s1 |
| InChIKey | WBJBEEPFEYGHFF-FKMACVBZSA-N |
| XLogP | 5.31 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|