C27H35N3O4S — CID 4546956
N-(3-ethoxyphenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4546956) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-(3-ethoxyphenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(3-ethoxyphenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4546956 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-(3-ethoxyphenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCCN1C(=O)CC(C(=O)Nc2cccc(OCC)c2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H35N3O4S/c1-4-6-7-8-9-17-30-25(31)19-24(26(32)28-21-11-10-12-23(18-21)34-5-2)35-27(30)29-20-13-15-22(33-3)16-14-20/h10-16,18,24H,4-9,17,19H2,1-3H3,(H,28,32)/b29-27- |
| InChIKey | BHNVYVWRYPXJPA-OHYPFYFLSA-N |
| XLogP | 6.02 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|