C25H30BrN3O3S — CID 4161197
N-(4-bromophenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4161197) has the molecular formula C25H30BrN3O3S and a molecular weight of 532.50 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-bromophenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4161197 |
| Molecular Formula | C25H30BrN3O3S |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | N-(4-bromophenyl)-3-heptyl-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCCN1C(=O)CC(C(=O)Nc2ccc(Br)cc2)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30BrN3O3S/c1-3-4-5-6-7-16-29-23(30)17-22(24(31)27-19-10-8-18(26)9-11-19)33-25(29)28-20-12-14-21(32-2)15-13-20/h8-15,22H,3-7,16-17H2,1-2H3,(H,27,31)/b28-25- |
| InChIKey | VQFOMVIOOQKKNR-FVDSYPCUSA-N |
| XLogP | 6.39 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|