C27H26FN3O3S — CID 4255901
N-(4-fluorophenyl)-2-(4-methoxyphenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide (PubChem CID 4255901) has the molecular formula C27H26FN3O3S and a molecular weight of 491.59 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(4-methoxyphenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-(4-methoxyphenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4255901 |
| Molecular Formula | C27H26FN3O3S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-(4-methoxyphenyl)imino-4-oxo-3-(3-phenylpropyl)-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(/N=C2\SC(C(=O)Nc3ccc(F)cc3)CC(=O)N2CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26FN3O3S/c1-34-23-15-13-22(14-16-23)30-27-31(17-5-8-19-6-3-2-4-7-19)25(32)18-24(35-27)26(33)29-21-11-9-20(28)10-12-21/h2-4,6-7,9-16,24H,5,8,17-18H2,1H3,(H,29,33)/b30-27- |
| InChIKey | LAWZJJRUGSWHRV-IKPAITLHSA-N |
| XLogP | 5.43 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|