C26H24FN3O2S — CID 40851132
(6S)-3-[2-(4-fluorophenyl)ethyl]-N-(3-methylphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide (PubChem CID 40851132) has the molecular formula C26H24FN3O2S and a molecular weight of 461.56 g/mol. Its IUPAC name is (6S)-3-[2-(4-fluorophenyl)ethyl]-N-(3-methylphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-3-[2-(4-fluorophenyl)ethyl]-N-(3-methylphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 40851132 |
| Molecular Formula | C26H24FN3O2S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (6S)-3-[2-(4-fluorophenyl)ethyl]-N-(3-methylphenyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@@H]2CC(=O)N(CCc3ccc(F)cc3)/C(=N/c3ccccc3)S2)c1 |
| InChI | InChI=1S/C26H24FN3O2S/c1-18-6-5-9-22(16-18)28-25(32)23-17-24(31)30(15-14-19-10-12-20(27)13-11-19)26(33-23)29-21-7-3-2-4-8-21/h2-13,16,23H,14-15,17H2,1H3,(H,28,32)/b29-26-/t23-/m0/s1 |
| InChIKey | ZATCPSIVKBURDZ-PNJMJVHGSA-N |
| XLogP | 5.34 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|