C19H18FN3O3S — CID 51410730
(6S)-N-(4-fluorophenyl)-3-(2-hydroxyethyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide (PubChem CID 51410730) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is (6S)-N-(4-fluorophenyl)-3-(2-hydroxyethyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-N-(4-fluorophenyl)-3-(2-hydroxyethyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 51410730 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (6S)-N-(4-fluorophenyl)-3-(2-hydroxyethyl)-4-oxo-2-phenylimino-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@@H]1CC(=O)N(CCO)/C(=N/c2ccccc2)S1 |
| InChI | InChI=1S/C19H18FN3O3S/c20-13-6-8-15(9-7-13)21-18(26)16-12-17(25)23(10-11-24)19(27-16)22-14-4-2-1-3-5-14/h1-9,16,24H,10-12H2,(H,21,26)/b22-19-/t16-/m0/s1 |
| InChIKey | PYSAZVNAUAINMS-VFOOBRQFSA-N |
| XLogP | 2.78 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|