C26H22ClN3O4S — CID 4656660
3-[[3-[2-(4-chlorophenyl)ethyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 4656660) has the molecular formula C26H22ClN3O4S and a molecular weight of 508.00 g/mol. Its IUPAC name is 3-[[3-[2-(4-chlorophenyl)ethyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[3-[2-(4-chlorophenyl)ethyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4656660 |
| Molecular Formula | C26H22ClN3O4S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 3-[[3-[2-(4-chlorophenyl)ethyl]-4-oxo-2-phenylimino-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C2CC(=O)N(CCc3ccc(Cl)cc3)/C(=N/c3ccccc3)S2)c1 |
| InChI | InChI=1S/C26H22ClN3O4S/c27-19-11-9-17(10-12-19)13-14-30-23(31)16-22(35-26(30)29-20-6-2-1-3-7-20)24(32)28-21-8-4-5-18(15-21)25(33)34/h1-12,15,22H,13-14,16H2,(H,28,32)(H,33,34)/b29-26- |
| InChIKey | AVUZWWMZNZTNAN-WCTVFOPTSA-N |
| XLogP | 5.24 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|