C25H22BrN3O2S — CID 4548001
N-(3-bromophenyl)-4-oxo-3-(2-phenylethyl)-2-phenylimino-1,3-thiazinane-6-carboxamide (PubChem CID 4548001) has the molecular formula C25H22BrN3O2S and a molecular weight of 508.44 g/mol. Its IUPAC name is N-(3-bromophenyl)-4-oxo-3-(2-phenylethyl)-2-phenylimino-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(3-bromophenyl)-4-oxo-3-(2-phenylethyl)-2-phenylimino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4548001 |
| Molecular Formula | C25H22BrN3O2S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | N-(3-bromophenyl)-4-oxo-3-(2-phenylethyl)-2-phenylimino-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CC(=O)N(CCc2ccccc2)/C(=N/c2ccccc2)S1 |
| InChI | InChI=1S/C25H22BrN3O2S/c26-19-10-7-13-21(16-19)27-24(31)22-17-23(30)29(15-14-18-8-3-1-4-9-18)25(32-22)28-20-11-5-2-6-12-20/h1-13,16,22H,14-15,17H2,(H,27,31)/b28-25- |
| InChIKey | UYXLTPDHBAXJAB-FVDSYPCUSA-N |
| XLogP | 5.65 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|