C26H22Cl3N3O3S — CID 4114672
2-(3-chlorophenyl)imino-N-(3,5-dichlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4114672) has the molecular formula C26H22Cl3N3O3S and a molecular weight of 562.91 g/mol. Its IUPAC name is 2-(3-chlorophenyl)imino-N-(3,5-dichlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3-chlorophenyl)imino-N-(3,5-dichlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4114672 |
| Molecular Formula | C26H22Cl3N3O3S |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 2-(3-chlorophenyl)imino-N-(3,5-dichlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CCN2C(=O)CC(C(=O)Nc3cc(Cl)cc(Cl)c3)S/C2=N\c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C26H22Cl3N3O3S/c1-35-22-7-5-16(6-8-22)9-10-32-24(33)15-23(25(34)30-21-13-18(28)11-19(29)14-21)36-26(32)31-20-4-2-3-17(27)12-20/h2-8,11-14,23H,9-10,15H2,1H3,(H,30,34)/b31-26- |
| InChIKey | NIYKAGALMXAMDZ-ZXPTYKNPSA-N |
| XLogP | 6.86 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|