C27H25ClFN3O4S — CID 3626732
N-(3-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3626732) has the molecular formula C27H25ClFN3O4S and a molecular weight of 542.03 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3626732 |
| Molecular Formula | C27H25ClFN3O4S |
| Molecular Weight | 542.03 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | N-(3-chlorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CCN2C(=O)CC(C(=O)Nc3cccc(Cl)c3)S/C2=N\c2ccccc2F)cc1OC |
| InChI | InChI=1S/C27H25ClFN3O4S/c1-35-22-11-10-17(14-23(22)36-2)12-13-32-25(33)16-24(26(34)30-19-7-5-6-18(28)15-19)37-27(32)31-21-9-4-3-8-20(21)29/h3-11,14-15,24H,12-13,16H2,1-2H3,(H,30,34)/b31-27- |
| InChIKey | BWILEKRZHUCGJT-QVTSOHHYSA-N |
| XLogP | 5.70 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.03 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|