C23H26FN3O4S — CID 42578627
(6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethylimino-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 42578627) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is (6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethylimino-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethylimino-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 42578627 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (6S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-ethylimino-N-(2-fluorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CC/N=C1\S[C@H](C(=O)Nc2ccccc2F)CC(=O)N1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H26FN3O4S/c1-4-25-23-27(12-11-15-9-10-18(30-2)19(13-15)31-3)21(28)14-20(32-23)22(29)26-17-8-6-5-7-16(17)24/h5-10,13,20H,4,11-12,14H2,1-3H3,(H,26,29)/b25-23-/t20-/m0/s1 |
| InChIKey | VIOTWEPYXITBFD-ZPKJPUMHSA-N |
| XLogP | 3.73 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|