C27H28N4O5S2 — CID 5165231
3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-thiazinane-6-carboxamide (PubChem CID 5165231) has the molecular formula C27H28N4O5S2 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 5165231 |
| Molecular Formula | C27H28N4O5S2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-N-[2-(4-sulfamoylphenyl)ethyl]-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CN2C(=O)CC(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N4O5S2/c1-36-22-11-7-20(8-12-22)18-31-25(32)17-24(37-27(31)30-21-5-3-2-4-6-21)26(33)29-16-15-19-9-13-23(14-10-19)38(28,34)35/h2-14,24H,15-18H2,1H3,(H,29,33)(H2,28,34,35)/b30-27- |
| InChIKey | HENCWJSXNNMZNK-IKPAITLHSA-N |
| XLogP | 3.22 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|