C21H20ClF2N3O3S — CID 3453002
2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2,4-dimethylphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3453002) has the molecular formula C21H20ClF2N3O3S and a molecular weight of 467.93 g/mol. Its IUPAC name is 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2,4-dimethylphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2,4-dimethylphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3453002 |
| Molecular Formula | C21H20ClF2N3O3S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 2-[4-[chloro(difluoro)methoxy]phenyl]imino-N-(2,4-dimethylphenyl)-3-methyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC(=O)N(C)/C(=N/c3ccc(OC(F)(F)Cl)cc3)S2)c(C)c1 |
| InChI | InChI=1S/C21H20ClF2N3O3S/c1-12-4-9-16(13(2)10-12)26-19(29)17-11-18(28)27(3)20(31-17)25-14-5-7-15(8-6-14)30-21(22,23)24/h4-10,17H,11H2,1-3H3,(H,26,29)/b25-20- |
| InChIKey | OOLIUENMFXLUKH-QQTULTPQSA-N |
| XLogP | 5.06 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|