C27H23F4N3O2S — CID 3304027
N-(2-fluorophenyl)-4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide (PubChem CID 3304027) has the molecular formula C27H23F4N3O2S and a molecular weight of 529.56 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3304027 |
| Molecular Formula | C27H23F4N3O2S |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | N-(2-fluorophenyl)-4-oxo-3-(3-phenylpropyl)-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazinane-6-carboxamide |
| SMILES | O=C(Nc1ccccc1F)C1CC(=O)N(CCCc2ccccc2)/C(=N/c2cccc(C(F)(F)F)c2)S1 |
| InChI | InChI=1S/C27H23F4N3O2S/c28-21-13-4-5-14-22(21)33-25(36)23-17-24(35)34(15-7-10-18-8-2-1-3-9-18)26(37-23)32-20-12-6-11-19(16-20)27(29,30)31/h1-6,8-9,11-14,16,23H,7,10,15,17H2,(H,33,36)/b32-26- |
| InChIKey | ANBZXYNRRDYZKO-FSRJSHLRSA-N |
| XLogP | 6.44 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|