C25H29Cl2N3O2S — CID 4137587
N-(3-chloro-4-methylphenyl)-2-(3-chlorophenyl)imino-3-heptyl-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 4137587) has the molecular formula C25H29Cl2N3O2S and a molecular weight of 506.50 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(3-chlorophenyl)imino-3-heptyl-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(3-chlorophenyl)imino-3-heptyl-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 4137587 |
| Molecular Formula | C25H29Cl2N3O2S |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(3-chlorophenyl)imino-3-heptyl-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCCCCCCN1C(=O)CC(C(=O)Nc2ccc(C)c(Cl)c2)S/C1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H29Cl2N3O2S/c1-3-4-5-6-7-13-30-23(31)16-22(24(32)28-20-12-11-17(2)21(27)15-20)33-25(30)29-19-10-8-9-18(26)14-19/h8-12,14-15,22H,3-7,13,16H2,1-2H3,(H,28,32)/b29-25- |
| InChIKey | FSFSMXQXHJDUTE-GNVQSUKOSA-N |
| XLogP | 7.23 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|