C19H26ClN3O2S — CID 7320678
(6S)-3-butyl-2-butylimino-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 7320678) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is (6S)-3-butyl-2-butylimino-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-3-butyl-2-butylimino-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 7320678 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (6S)-3-butyl-2-butylimino-N-(3-chlorophenyl)-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCCC/N=C1\S[C@H](C(=O)Nc2cccc(Cl)c2)CC(=O)N1CCCC |
| InChI | InChI=1S/C19H26ClN3O2S/c1-3-5-10-21-19-23(11-6-4-2)17(24)13-16(26-19)18(25)22-15-9-7-8-14(20)12-15/h7-9,12,16H,3-6,10-11,13H2,1-2H3,(H,22,25)/b21-19-/t16-/m0/s1 |
| InChIKey | APLKUXYZRXEDMR-XOMICKMZSA-N |
| XLogP | 4.57 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|