C21H20IN3O4S — CID 98307927
ethyl 4-[[(5S)-5-[2-(4-iodoanilino)-2-oxoethyl]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 98307927) has the molecular formula C21H20IN3O4S and a molecular weight of 537.38 g/mol. Its IUPAC name is ethyl 4-[[(5S)-5-[2-(4-iodoanilino)-2-oxoethyl]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[(5S)-5-[2-(4-iodoanilino)-2-oxoethyl]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 98307927 |
| Molecular Formula | C21H20IN3O4S |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | ethyl 4-[[(5S)-5-[2-(4-iodoanilino)-2-oxoethyl]-3-methyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/S[C@@H](CC(=O)Nc3ccc(I)cc3)C(=O)N2C)cc1 |
| InChI | InChI=1S/C21H20IN3O4S/c1-3-29-20(28)13-4-8-16(9-5-13)24-21-25(2)19(27)17(30-21)12-18(26)23-15-10-6-14(22)7-11-15/h4-11,17H,3,12H2,1-2H3,(H,23,26)/b24-21+/t17-/m0/s1 |
| InChIKey | WDSVQJMVKXOPLX-NPNYCVGBSA-N |
| XLogP | 4.06 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|