C18H16IN3O2S — CID 17382439
2-[2-(4-iodophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 17382439) has the molecular formula C18H16IN3O2S and a molecular weight of 465.32 g/mol. Its IUPAC name is 2-[2-(4-iodophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[2-(4-iodophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 17382439 |
| Molecular Formula | C18H16IN3O2S |
| Molecular Weight | 465.32 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 2-[2-(4-iodophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | CN1C(=O)C(CC(=O)Nc2ccccc2)S/C1=N/c1ccc(I)cc1 |
| InChI | InChI=1S/C18H16IN3O2S/c1-22-17(24)15(11-16(23)20-13-5-3-2-4-6-13)25-18(22)21-14-9-7-12(19)8-10-14/h2-10,15H,11H2,1H3,(H,20,23)/b21-18+ |
| InChIKey | JFLDHNMPTNIZSD-DYTRJAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|