C26H22F3N3O3S — CID 41242615
2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 41242615) has the molecular formula C26H22F3N3O3S and a molecular weight of 513.54 g/mol. Its IUPAC name is 2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 41242615 |
| Molecular Formula | C26H22F3N3O3S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 2-[(5S)-3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)C[C@@H]2S/C(=N\c3ccc(C(F)(F)F)cc3)N(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C26H22F3N3O3S/c1-35-21-9-5-8-20(14-21)30-23(33)15-22-24(34)32(16-17-6-3-2-4-7-17)25(36-22)31-19-12-10-18(11-13-19)26(27,28)29/h2-14,22H,15-16H2,1H3,(H,30,33)/b31-25-/t22-/m0/s1 |
| InChIKey | JSWHDDSSUMEJCV-NGNZEAJZSA-N |
| XLogP | 5.87 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|