C27H24F3N3O2S — CID 5108578
2-[3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide (PubChem CID 5108578) has the molecular formula C27H24F3N3O2S and a molecular weight of 511.57 g/mol. Its IUPAC name is 2-[3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 5108578 |
| Molecular Formula | C27H24F3N3O2S |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 2-[3-benzyl-4-oxo-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CC1S/C(=N\c2ccc(C(F)(F)F)cc2)N(Cc2ccccc2)C1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C27H24F3N3O2S/c28-27(29,30)21-11-13-22(14-12-21)32-26-33(18-20-9-5-2-6-10-20)25(35)23(36-26)17-24(34)31-16-15-19-7-3-1-4-8-19/h1-14,23H,15-18H2,(H,31,34)/b32-26- |
| InChIKey | SFXBTMQVVMAQBO-FSRJSHLRSA-N |
| XLogP | 5.59 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|