C19H17ClFN3O2S — CID 40647344
N-(3-chlorophenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 40647344) has the molecular formula C19H17ClFN3O2S and a molecular weight of 405.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 40647344 |
| Molecular Formula | C19H17ClFN3O2S |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCN1C(=O)[C@@H](CC(=O)Nc2cccc(Cl)c2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17ClFN3O2S/c1-2-24-18(26)16(11-17(25)22-15-5-3-4-12(20)10-15)27-19(24)23-14-8-6-13(21)7-9-14/h3-10,16H,2,11H2,1H3,(H,22,25)/b23-19-/t16-/m1/s1 |
| InChIKey | QDBYVFRUMGHTTF-LTUQMTLXSA-N |
| XLogP | 4.46 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|