C21H22FN3O2S — CID 7318827
N-(2,4-dimethylphenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 7318827) has the molecular formula C21H22FN3O2S and a molecular weight of 399.49 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 7318827 |
| Molecular Formula | C21H22FN3O2S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(5R)-3-ethyl-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCN1C(=O)[C@@H](CC(=O)Nc2ccc(C)cc2C)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN3O2S/c1-4-25-20(27)18(28-21(25)23-16-8-6-15(22)7-9-16)12-19(26)24-17-10-5-13(2)11-14(17)3/h5-11,18H,4,12H2,1-3H3,(H,24,26)/b23-21-/t18-/m1/s1 |
| InChIKey | XEMZSKHGZAEFPQ-GLEDVZQVSA-N |
| XLogP | 4.42 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|