C24H29N3O2S — CID 18281187
2-[3-butyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 18281187) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-[3-butyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[3-butyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 18281187 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[3-butyl-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | CCCCN1C(=O)C(CC(=O)Nc2cc(C)ccc2C)S/C1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C24H29N3O2S/c1-5-6-13-27-23(29)21(30-24(27)25-19-11-8-16(2)9-12-19)15-22(28)26-20-14-17(3)7-10-18(20)4/h7-12,14,21H,5-6,13,15H2,1-4H3,(H,26,28)/b25-24- |
| InChIKey | RXHTWTFAVYCBKL-IZHYLOQSSA-N |
| XLogP | 5.37 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|