C25H31N3O3S — CID 42994016
N-(2,5-dimethylphenyl)-2-[2-(2,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 42994016) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[2-(2,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[2-(2,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 42994016 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[2-(2,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COCCCN1C(=O)C(CC(=O)Nc2cc(C)ccc2C)S/C1=N\c1cc(C)ccc1C |
| InChI | InChI=1S/C25H31N3O3S/c1-16-7-9-18(3)20(13-16)26-23(29)15-22-24(30)28(11-6-12-31-5)25(32-22)27-21-14-17(2)8-10-19(21)4/h7-10,13-14,22H,6,11-12,15H2,1-5H3,(H,26,29)/b27-25- |
| InChIKey | WTWQDJWISVPTJJ-RFBIWTDZSA-N |
| XLogP | 4.92 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|