C24H28ClN3O3S — CID 46802671
N-(3-chloro-2-methylphenyl)-2-[2-(2,4-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 46802671) has the molecular formula C24H28ClN3O3S and a molecular weight of 474.03 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[2-(2,4-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[2-(2,4-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 46802671 |
| Molecular Formula | C24H28ClN3O3S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[2-(2,4-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COCCCN1C(=O)C(CC(=O)Nc2cccc(Cl)c2C)S/C1=N\c1ccc(C)cc1C |
| InChI | InChI=1S/C24H28ClN3O3S/c1-15-9-10-19(16(2)13-15)27-24-28(11-6-12-31-4)23(30)21(32-24)14-22(29)26-20-8-5-7-18(25)17(20)3/h5,7-10,13,21H,6,11-12,14H2,1-4H3,(H,26,29)/b27-24- |
| InChIKey | KAERLZIQWMKWQS-PNHLSOANSA-N |
| XLogP | 5.26 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|