C24H29N3O4S — CID 42990888
2-[2-(2,6-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 42990888) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-(2,6-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42990888 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-[2-(2,6-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COCCCN1C(=O)C(CC(=O)Nc2ccccc2OC)S/C1=N\c1c(C)cccc1C |
| InChI | InChI=1S/C24H29N3O4S/c1-16-9-7-10-17(2)22(16)26-24-27(13-8-14-30-3)23(29)20(32-24)15-21(28)25-18-11-5-6-12-19(18)31-4/h5-7,9-12,20H,8,13-15H2,1-4H3,(H,25,28)/b26-24- |
| InChIKey | VYXPKVUDYGFVAS-LCUIJRPUSA-N |
| XLogP | 4.31 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|