C26H33N3O5S — CID 42994082
N-(2,4-dimethoxyphenyl)-2-[2-(2,6-dimethylphenyl)imino-3-(3-ethoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 42994082) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[2-(2,6-dimethylphenyl)imino-3-(3-ethoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[2-(2,6-dimethylphenyl)imino-3-(3-ethoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 42994082 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[2-(2,6-dimethylphenyl)imino-3-(3-ethoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCOCCCN1C(=O)C(CC(=O)Nc2ccc(OC)cc2OC)S/C1=N\c1c(C)cccc1C |
| InChI | InChI=1S/C26H33N3O5S/c1-6-34-14-8-13-29-25(31)22(35-26(29)28-24-17(2)9-7-10-18(24)3)16-23(30)27-20-12-11-19(32-4)15-21(20)33-5/h7,9-12,15,22H,6,8,13-14,16H2,1-5H3,(H,27,30)/b28-26- |
| InChIKey | COILTZAKGGZYCC-SGEDCAFJSA-N |
| XLogP | 4.71 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|