C17H26N2O8 — CID 175652872
N-(2,4-dimethoxyphenyl)-2-(3-ethoxypropylamino)acetamide;oxalic acid (PubChem CID 175652872) has the molecular formula C17H26N2O8 and a molecular weight of 386.40 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(3-ethoxypropylamino)acetamide;oxalic acid.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(3-ethoxypropylamino)acetamide;oxalic acid |
|---|---|
| PubChem CID | 175652872 |
| Molecular Formula | C17H26N2O8 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(3-ethoxypropylamino)acetamide;oxalic acid |
| SMILES | CCOCCCNCC(=O)Nc1ccc(OC)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H24N2O4.C2H2O4/c1-4-21-9-5-8-16-11-15(18)17-13-7-6-12(19-2)10-14(13)20-3;3-1(4)2(5)6/h6-7,10,16H,4-5,8-9,11H2,1-3H3,(H,17,18);(H,3,4)(H,5,6) |
| InChIKey | DMZRWRYHLJOKIG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|