C23H26ClN3O5S — CID 5051918
2-[2-(4-chlorophenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 5051918) has the molecular formula C23H26ClN3O5S and a molecular weight of 492.00 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5051918 |
| Molecular Formula | C23H26ClN3O5S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[2-(4-chlorophenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COCCCN1C(=O)C(CC(=O)Nc2cc(OC)ccc2OC)S/C1=N\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26ClN3O5S/c1-30-12-4-11-27-22(29)20(33-23(27)25-16-7-5-15(24)6-8-16)14-21(28)26-18-13-17(31-2)9-10-19(18)32-3/h5-10,13,20H,4,11-12,14H2,1-3H3,(H,26,28)/b25-23- |
| InChIKey | ZZWWVQIFISFPRT-BZZOAKBMSA-N |
| XLogP | 4.35 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|