C23H25Cl2N3O3S — CID 46802663
N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 46802663) has the molecular formula C23H25Cl2N3O3S and a molecular weight of 494.44 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 46802663 |
| Molecular Formula | C23H25Cl2N3O3S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-(3-methoxypropyl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COCCCN1C(=O)C(CC(=O)Nc2cccc(Cl)c2Cl)S/C1=N\c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C23H25Cl2N3O3S/c1-14-10-15(2)12-16(11-14)26-23-28(8-5-9-31-3)22(30)19(32-23)13-20(29)27-18-7-4-6-17(24)21(18)25/h4,6-7,10-12,19H,5,8-9,13H2,1-3H3,(H,27,29)/b26-23- |
| InChIKey | FNCWXBKIBIGYSI-RWEWTDSWSA-N |
| XLogP | 5.61 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|