C20H19Cl2N3O2S — CID 45143362
N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 45143362) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 45143362 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1cc(C)cc(/N=C2\SC(CC(=O)Nc3cccc(Cl)c3Cl)C(=O)N2C)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2S/c1-11-7-12(2)9-13(8-11)23-20-25(3)19(27)16(28-20)10-17(26)24-15-6-4-5-14(21)18(15)22/h4-9,16H,10H2,1-3H3,(H,24,26)/b23-20- |
| InChIKey | CISPUKSAUGTADJ-ATJXCDBQSA-N |
| XLogP | 5.20 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|