C22H21Cl2N3O2S — CID 1498567
N-(2,3-dichlorophenyl)-2-[(5S)-2-(3,4-dimethylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide (PubChem CID 1498567) has the molecular formula C22H21Cl2N3O2S and a molecular weight of 462.40 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[(5S)-2-(3,4-dimethylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[(5S)-2-(3,4-dimethylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 1498567 |
| Molecular Formula | C22H21Cl2N3O2S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[(5S)-2-(3,4-dimethylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=CCN1C(=O)[C@H](CC(=O)Nc2cccc(Cl)c2Cl)S/C1=N\c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H21Cl2N3O2S/c1-4-10-27-21(29)18(12-19(28)26-17-7-5-6-16(23)20(17)24)30-22(27)25-15-9-8-13(2)14(3)11-15/h4-9,11,18H,1,10,12H2,2-3H3,(H,26,28)/b25-22-/t18-/m0/s1 |
| InChIKey | HPOQTWRKSTXAKN-FGGSVNHKSA-N |
| XLogP | 5.76 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|