C22H23N3O2S — CID 2185030
N-(2,6-dimethylphenyl)-2-[(5S)-4-oxo-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide (PubChem CID 2185030) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(5S)-4-oxo-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(5S)-4-oxo-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 2185030 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(5S)-4-oxo-2-phenylimino-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=CCN1C(=O)[C@H](CC(=O)Nc2c(C)cccc2C)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C22H23N3O2S/c1-4-13-25-21(27)18(28-22(25)23-17-11-6-5-7-12-17)14-19(26)24-20-15(2)9-8-10-16(20)3/h4-12,18H,1,13-14H2,2-3H3,(H,24,26)/b23-22+/t18-/m0/s1 |
| InChIKey | UYLOSNRXLJAGQX-CCWVLBSLSA-N |
| XLogP | 4.45 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|