C23H24ClN3O2S — CID 1218059
2-[(5S)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 1218059) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-[(5S)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[(5S)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 1218059 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[(5S)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | C=CCN1C(=O)[C@H](CC(=O)Nc2cccc(C)c2C)S/C1=N\c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C23H24ClN3O2S/c1-5-11-27-22(29)20(13-21(28)26-19-8-6-7-14(2)16(19)4)30-23(27)25-17-10-9-15(3)18(24)12-17/h5-10,12,20H,1,11,13H2,2-4H3,(H,26,28)/b25-23-/t20-/m0/s1 |
| InChIKey | KTPDPPXJUVXQGD-ZPKJPUMHSA-N |
| XLogP | 5.41 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|