C23H22ClN3O3S — CID 1218061
N-(3-acetylphenyl)-2-[(5R)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide (PubChem CID 1218061) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(5R)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[(5R)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 1218061 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(5R)-2-(3-chloro-4-methylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=CCN1C(=O)[C@@H](CC(=O)Nc2cccc(C(C)=O)c2)S/C1=N\c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-4-10-27-22(30)20(31-23(27)26-18-9-8-14(2)19(24)12-18)13-21(29)25-17-7-5-6-16(11-17)15(3)28/h4-9,11-12,20H,1,10,13H2,2-3H3,(H,25,29)/b26-23-/t20-/m1/s1 |
| InChIKey | FRLVPUOHVGALSI-HZYJKNPPSA-N |
| XLogP | 5.00 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|