C24H25N3O3S — CID 3290366
2-[2-(4-acetylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 3290366) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 2-[2-(4-acetylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[2-(4-acetylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 3290366 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[2-(4-acetylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | C=CCN1C(=O)C(CC(=O)Nc2ccccc2CC)S/C1=N\c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-4-14-27-23(30)21(15-22(29)26-20-9-7-6-8-17(20)5-2)31-24(27)25-19-12-10-18(11-13-19)16(3)28/h4,6-13,21H,1,5,14-15H2,2-3H3,(H,26,29)/b25-24- |
| InChIKey | BONCMVSCQSMKKF-IZHYLOQSSA-N |
| XLogP | 4.60 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|