C20H20BrN3O2S — CID 45143363
N-(2-bromophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 45143363) has the molecular formula C20H20BrN3O2S and a molecular weight of 446.37 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 45143363 |
| Molecular Formula | C20H20BrN3O2S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | N-(2-bromophenyl)-2-[2-(3,5-dimethylphenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1cc(C)cc(/N=C2\SC(CC(=O)Nc3ccccc3Br)C(=O)N2C)c1 |
| InChI | InChI=1S/C20H20BrN3O2S/c1-12-8-13(2)10-14(9-12)22-20-24(3)19(26)17(27-20)11-18(25)23-16-7-5-4-6-15(16)21/h4-10,17H,11H2,1-3H3,(H,23,25)/b22-20- |
| InChIKey | IWJXPEWLASPSFA-XDOYNYLZSA-N |
| XLogP | 4.66 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|