C22H22FN3O2S — CID 2700552
2-[(5S)-3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 2700552) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-[(5S)-3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(5S)-3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2700552 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[(5S)-3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | Cc1cc(C)cc(/N=C2\S[C@@H](CC(=O)Nc3ccccc3F)C(=O)N2C2CC2)c1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-13-9-14(2)11-15(10-13)24-22-26(16-7-8-16)21(28)19(29-22)12-20(27)25-18-6-4-3-5-17(18)23/h3-6,9-11,16,19H,7-8,12H2,1-2H3,(H,25,27)/b24-22-/t19-/m0/s1 |
| InChIKey | LAIAFBFPYZOREU-COPMAWBXSA-N |
| XLogP | 4.57 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|