C22H21ClN4O4S — CID 42994132
N-(2-chloro-5-nitrophenyl)-2-[3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 42994132) has the molecular formula C22H21ClN4O4S and a molecular weight of 472.95 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 42994132 |
| Molecular Formula | C22H21ClN4O4S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[3-cyclopropyl-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1cc(C)cc(/N=C2\SC(CC(=O)Nc3cc([N+](=O)[O-])ccc3Cl)C(=O)N2C2CC2)c1 |
| InChI | InChI=1S/C22H21ClN4O4S/c1-12-7-13(2)9-14(8-12)24-22-26(15-3-4-15)21(29)19(32-22)11-20(28)25-18-10-16(27(30)31)5-6-17(18)23/h5-10,15,19H,3-4,11H2,1-2H3,(H,25,28)/b24-22- |
| InChIKey | XSFAUEHTCKTZIY-GYHWCHFESA-N |
| XLogP | 4.99 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|