C24H27N3O2S — CID 7974349
2-[(5S)-3-cyclopropyl-2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 7974349) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-[(5S)-3-cyclopropyl-2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[(5S)-3-cyclopropyl-2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 7974349 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[(5S)-3-cyclopropyl-2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | CCc1ccc(/N=C2\S[C@@H](CC(=O)Nc3cc(C)ccc3C)C(=O)N2C2CC2)cc1 |
| InChI | InChI=1S/C24H27N3O2S/c1-4-17-7-9-18(10-8-17)25-24-27(19-11-12-19)23(29)21(30-24)14-22(28)26-20-13-15(2)5-6-16(20)3/h5-10,13,19,21H,4,11-12,14H2,1-3H3,(H,26,28)/b25-24-/t21-/m0/s1 |
| InChIKey | SOKUYSJQEXQMLB-VHAJSEAWSA-N |
| XLogP | 4.99 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|