C21H21Cl2N3O2S — CID 40830240
2-[(5S)-2-(2,3-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 40830240) has the molecular formula C21H21Cl2N3O2S and a molecular weight of 450.39 g/mol. Its IUPAC name is 2-[(5S)-2-(2,3-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(5S)-2-(2,3-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 40830240 |
| Molecular Formula | C21H21Cl2N3O2S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[(5S)-2-(2,3-dichlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C[C@@H]2S/C(=N/c3cccc(Cl)c3Cl)N(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H21Cl2N3O2S/c1-11-8-12(2)19(13(3)9-11)25-17(27)10-16-20(28)26(4)21(29-16)24-15-7-5-6-14(22)18(15)23/h5-9,16H,10H2,1-4H3,(H,25,27)/b24-21+/t16-/m0/s1 |
| InChIKey | GBTYOGHBXQMUFW-ASLPFPAGSA-N |
| XLogP | 5.51 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|